C4H4NaNiO9P — CID 175079698
sodium;2,3-dihydroxy-4-oxo-4-phosphonatooxybutanoate;nickel(2+) (PubChem CID 175079698) has the molecular formula C4H4NaNiO9P and a molecular weight of 308.72 g/mol. Its IUPAC name is sodium;2,3-dihydroxy-4-oxo-4-phosphonatooxybutanoate;nickel(2+).
| Compound Name | sodium;2,3-dihydroxy-4-oxo-4-phosphonatooxybutanoate;nickel(2+) |
|---|---|
| PubChem CID | 175079698 |
| Molecular Formula | C4H4NaNiO9P |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 307.88 |
| IUPAC Name | sodium;2,3-dihydroxy-4-oxo-4-phosphonatooxybutanoate;nickel(2+) |
| SMILES | O=C([O-])C(O)C(O)C(=O)OP(=O)([O-])[O-].[Na+].[Ni+2] |
| InChI | InChI=1S/C4H7O9P.Na.Ni/c5-1(3(7)8)2(6)4(9)13-14(10,11)12;;/h1-2,5-6H,(H,7,8)(H2,10,11,12);;/q;+1;+2/p-3 |
| InChIKey | YDOUYRZUQWILHA-UHFFFAOYSA-K |
| XLogP | -8.17 |
| TPSA | 170.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | -8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|