C4H6KNO6 — CID 174636110
potassium 4-aminooxy-2,3-dihydroxy-4-oxobutanoate (PubChem CID 174636110) has the molecular formula C4H6KNO6 and a molecular weight of 203.19 g/mol. Its IUPAC name is potassium 4-aminooxy-2,3-dihydroxy-4-oxobutanoate.
| Compound Name | potassium 4-aminooxy-2,3-dihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 174636110 |
| Molecular Formula | C4H6KNO6 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 202.98 |
| IUPAC Name | potassium 4-aminooxy-2,3-dihydroxy-4-oxobutanoate |
| SMILES | NOC(=O)C(O)C(O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C4H7NO6.K/c5-11-4(10)2(7)1(6)3(8)9;/h1-2,6-7H,5H2,(H,8,9);/q;+1/p-1 |
| InChIKey | BMEBDGCUPVHVMY-UHFFFAOYSA-M |
| XLogP | -7.12 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|