C4H10NO6Sb — CID 173395440
azanium 2,3-dihydroxy-4-oxo-4-stibanyloxybutanoate (PubChem CID 173395440) has the molecular formula C4H10NO6Sb and a molecular weight of 289.89 g/mol. Its IUPAC name is azanium 2,3-dihydroxy-4-oxo-4-stibanyloxybutanoate.
| Compound Name | azanium 2,3-dihydroxy-4-oxo-4-stibanyloxybutanoate |
|---|---|
| PubChem CID | 173395440 |
| Molecular Formula | C4H10NO6Sb |
| Molecular Weight | 289.89 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | azanium 2,3-dihydroxy-4-oxo-4-stibanyloxybutanoate |
| SMILES | O=C([O-])C(O)C(O)C(=O)O[SbH2].[NH4+] |
| InChI | InChI=1S/C4H6O6.H3N.Sb.2H/c5-1(3(7)8)2(6)4(9)10;;;;/h1-2,5-6H,(H,7,8)(H,9,10);1H3;;;/q;;+1;;/p-1 |
| InChIKey | RHACWNXNBBBLNW-UHFFFAOYSA-M |
| XLogP | -4.07 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.89 |
| LogP ≤ 5 | -4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|