C4H4NaO7Sb — CID 91886487
sodium (2R,3R)-2,3-dihydroxy-4-oxo-4-oxostibanyloxybutanoate (PubChem CID 91886487) has the molecular formula C4H4NaO7Sb and a molecular weight of 308.82 g/mol. Its IUPAC name is sodium (2R,3R)-2,3-dihydroxy-4-oxo-4-oxostibanyloxybutanoate.
| Compound Name | sodium (2R,3R)-2,3-dihydroxy-4-oxo-4-oxostibanyloxybutanoate |
|---|---|
| PubChem CID | 91886487 |
| Molecular Formula | C4H4NaO7Sb |
| Molecular Weight | 308.82 g/mol |
| Exact Mass | 307.89 |
| IUPAC Name | sodium (2R,3R)-2,3-dihydroxy-4-oxo-4-oxostibanyloxybutanoate |
| SMILES | O=[Sb]OC(=O)[C@H](O)[C@@H](O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H6O6.Na.O.Sb/c5-1(3(7)8)2(6)4(9)10;;;/h1-2,5-6H,(H,7,8)(H,9,10);;;/q;+1;;+1/p-2/t1-,2-;;;/m1.../s1 |
| InChIKey | SHFQLHLDZDETGN-QXMMYYGRSA-L |
| XLogP | -7.03 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.82 |
| LogP ≤ 5 | -7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|