C6H10ClO8P-2 — CID 135056618
[(5R)-6-chloro-3,4,5-trihydroxy-2-oxohexyl] phosphate (PubChem CID 135056618) has the molecular formula C6H10ClO8P-2 and a molecular weight of 276.57 g/mol. Its IUPAC name is [(5R)-6-chloro-3,4,5-trihydroxy-2-oxohexyl] phosphate.
| Compound Name | [(5R)-6-chloro-3,4,5-trihydroxy-2-oxohexyl] phosphate |
|---|---|
| PubChem CID | 135056618 |
| Molecular Formula | C6H10ClO8P-2 |
| Molecular Weight | 276.57 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | [(5R)-6-chloro-3,4,5-trihydroxy-2-oxohexyl] phosphate |
| SMILES | O=C(COP(=O)([O-])[O-])C(O)C(O)[C@@H](O)CCl |
| InChI | InChI=1S/C6H12ClO8P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3,5-6,8,10-11H,1-2H2,(H2,12,13,14)/p-2/t3-,5?,6?/m0/s1 |
| InChIKey | CXNZMHDRXNETEU-ORLPHIGFSA-L |
| XLogP | -3.28 |
| TPSA | 150.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.57 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|