C7H11O8P-2 — CID 135070166
[(5S)-3,4,5-trihydroxy-2-oxohept-6-enyl] phosphate (PubChem CID 135070166) has the molecular formula C7H11O8P-2 and a molecular weight of 254.13 g/mol. Its IUPAC name is [(5S)-3,4,5-trihydroxy-2-oxohept-6-enyl] phosphate.
| Compound Name | [(5S)-3,4,5-trihydroxy-2-oxohept-6-enyl] phosphate |
|---|---|
| PubChem CID | 135070166 |
| Molecular Formula | C7H11O8P-2 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | [(5S)-3,4,5-trihydroxy-2-oxohept-6-enyl] phosphate |
| SMILES | C=C[C@H](O)C(O)C(O)C(=O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C7H13O8P/c1-2-4(8)6(10)7(11)5(9)3-15-16(12,13)14/h2,4,6-8,10-11H,1,3H2,(H2,12,13,14)/p-2/t4-,6?,7?/m0/s1 |
| InChIKey | GCOILUGSBNVPEV-ISGODVSSSA-L |
| XLogP | -3.33 |
| TPSA | 150.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|