C6H11O8PS — CID 87930759
[(3R,4S)-3,4,5-trihydroxy-2-oxo-6-sulfanylidenehexyl] dihydrogen phosphate (PubChem CID 87930759) has the molecular formula C6H11O8PS and a molecular weight of 274.19 g/mol. Its IUPAC name is [(3R,4S)-3,4,5-trihydroxy-2-oxo-6-sulfanylidenehexyl] dihydrogen phosphate.
| Compound Name | [(3R,4S)-3,4,5-trihydroxy-2-oxo-6-sulfanylidenehexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87930759 |
| Molecular Formula | C6H11O8PS |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | [(3R,4S)-3,4,5-trihydroxy-2-oxo-6-sulfanylidenehexyl] dihydrogen phosphate |
| SMILES | O=C(COP(=O)(O)O)[C@H](O)[C@H](O)C(O)C=S |
| InChI | InChI=1S/C6H11O8PS/c7-3(1-14-15(11,12)13)5(9)6(10)4(8)2-16/h2,4-6,8-10H,1H2,(H2,11,12,13)/t4?,5-,6+/m0/s1 |
| InChIKey | FIQBEBAUCXBQLX-DUAGOPDLSA-N |
| XLogP | -2.25 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|