C6H13O7P — CID 14844446
[(3R,4S)-3,4-dihydroxy-2-oxohexyl] dihydrogen phosphate (PubChem CID 14844446) has the molecular formula C6H13O7P and a molecular weight of 228.14 g/mol. Its IUPAC name is [(3R,4S)-3,4-dihydroxy-2-oxohexyl] dihydrogen phosphate.
| Compound Name | [(3R,4S)-3,4-dihydroxy-2-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 14844446 |
| Molecular Formula | C6H13O7P |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | [(3R,4S)-3,4-dihydroxy-2-oxohexyl] dihydrogen phosphate |
| SMILES | CC[C@H](O)[C@@H](O)C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C6H13O7P/c1-2-4(7)6(9)5(8)3-13-14(10,11)12/h4,6-7,9H,2-3H2,1H3,(H2,10,11,12)/t4-,6+/m0/s1 |
| InChIKey | SHCSIRRKLZQXBC-UJURSFKZSA-N |
| XLogP | -1.20 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|