C8H13O10P — CID 101088701
(5R,6S)-5,6-dihydroxy-2,7-dioxo-8-phosphonooxyoctanoic acid (PubChem CID 101088701) has the molecular formula C8H13O10P and a molecular weight of 300.16 g/mol. Its IUPAC name is (5R,6S)-5,6-dihydroxy-2,7-dioxo-8-phosphonooxyoctanoic acid.
| Compound Name | (5R,6S)-5,6-dihydroxy-2,7-dioxo-8-phosphonooxyoctanoic acid |
|---|---|
| PubChem CID | 101088701 |
| Molecular Formula | C8H13O10P |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (5R,6S)-5,6-dihydroxy-2,7-dioxo-8-phosphonooxyoctanoic acid |
| SMILES | O=C(O)C(=O)CC[C@@H](O)[C@H](O)C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C8H13O10P/c9-4(1-2-5(10)8(13)14)7(12)6(11)3-18-19(15,16)17/h4,7,9,12H,1-3H2,(H,13,14)(H2,15,16,17)/t4-,7+/m1/s1 |
| InChIKey | COCJXLSLWMYOBJ-FBCQKBJTSA-N |
| XLogP | -2.18 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|