C9H19O10P — CID 157152928
(2S)-2-hydroxypropanal;[(3R,4R,5S)-3,4,5-trihydroxy-2-oxohexyl] dihydrogen phosphate (PubChem CID 157152928) has the molecular formula C9H19O10P and a molecular weight of 318.22 g/mol. Its IUPAC name is (2S)-2-hydroxypropanal;[(3R,4R,5S)-3,4,5-trihydroxy-2-oxohexyl] dihydrogen phosphate.
| Compound Name | (2S)-2-hydroxypropanal;[(3R,4R,5S)-3,4,5-trihydroxy-2-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 157152928 |
| Molecular Formula | C9H19O10P |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (2S)-2-hydroxypropanal;[(3R,4R,5S)-3,4,5-trihydroxy-2-oxohexyl] dihydrogen phosphate |
| SMILES | C[C@H](O)C=O.C[C@H](O)[C@@H](O)[C@@H](O)C(=O)COP(=O)(O)O |
| InChI | InChI=1S/C6H13O8P.C3H6O2/c1-3(7)5(9)6(10)4(8)2-14-15(11,12)13;1-3(5)2-4/h3,5-7,9-10H,2H2,1H3,(H2,11,12,13);2-3,5H,1H3/t3-,5+,6-;3-/m00/s1 |
| InChIKey | ALLSJNOSDXTKKW-UNRBXWQUSA-N |
| XLogP | -2.67 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|