C14H18NO9P-2 — CID 135057897
[(3R,4S,5R)-3,4-dihydroxy-2-oxo-5-(phenylmethoxycarbonylamino)hexyl] phosphate (PubChem CID 135057897) has the molecular formula C14H18NO9P-2 and a molecular weight of 375.27 g/mol. Its IUPAC name is [(3R,4S,5R)-3,4-dihydroxy-2-oxo-5-(phenylmethoxycarbonylamino)hexyl] phosphate.
| Compound Name | [(3R,4S,5R)-3,4-dihydroxy-2-oxo-5-(phenylmethoxycarbonylamino)hexyl] phosphate |
|---|---|
| PubChem CID | 135057897 |
| Molecular Formula | C14H18NO9P-2 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | [(3R,4S,5R)-3,4-dihydroxy-2-oxo-5-(phenylmethoxycarbonylamino)hexyl] phosphate |
| SMILES | C[C@@H](NC(=O)OCc1ccccc1)[C@H](O)[C@@H](O)C(=O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C14H20NO9P/c1-9(12(17)13(18)11(16)8-24-25(20,21)22)15-14(19)23-7-10-5-3-2-4-6-10/h2-6,9,12-13,17-18H,7-8H2,1H3,(H,15,19)(H2,20,21,22)/p-2/t9-,12+,13+/m1/s1 |
| InChIKey | QWJUOZUIINVBPO-ICCXJUOJSA-L |
| XLogP | -1.56 |
| TPSA | 168.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|