C11H20O7 — CID 141180344
2,3,4,5,6-pentahydroxyhexyl 2-methylbut-2-enoate (PubChem CID 141180344) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexyl 2-methylbut-2-enoate.
| Compound Name | 2,3,4,5,6-pentahydroxyhexyl 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 141180344 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexyl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C11H20O7/c1-3-6(2)11(17)18-5-8(14)10(16)9(15)7(13)4-12/h3,7-10,12-16H,4-5H2,1-2H3 |
| InChIKey | NCHDPKSUSOVAIW-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|