C9H16O7 — CID 54377750
[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] prop-2-enoate (PubChem CID 54377750) has the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] prop-2-enoate.
| Compound Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] prop-2-enoate |
|---|---|
| PubChem CID | 54377750 |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] prop-2-enoate |
| SMILES | C=CC(=O)OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H16O7/c1-2-7(13)16-4-6(12)9(15)8(14)5(11)3-10/h2,5-6,8-12,14-15H,1,3-4H2/t5-,6+,8-,9-/m1/s1 |
| InChIKey | UXTCOQLYVWVMMO-HSLWUYEYSA-N |
| XLogP | -2.85 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|