C12H18O7 — CID 118535897
[(3R,4S,5S)-3,4,5-trihydroxy-6-prop-2-enoyloxyhexyl] prop-2-enoate (PubChem CID 118535897) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is [(3R,4S,5S)-3,4,5-trihydroxy-6-prop-2-enoyloxyhexyl] prop-2-enoate.
| Compound Name | [(3R,4S,5S)-3,4,5-trihydroxy-6-prop-2-enoyloxyhexyl] prop-2-enoate |
|---|---|
| PubChem CID | 118535897 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [(3R,4S,5S)-3,4,5-trihydroxy-6-prop-2-enoyloxyhexyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC[C@@H](O)[C@H](O)[C@@H](O)COC(=O)C=C |
| InChI | InChI=1S/C12H18O7/c1-3-10(15)18-6-5-8(13)12(17)9(14)7-19-11(16)4-2/h3-4,8-9,12-14,17H,1-2,5-7H2/t8-,9+,12+/m1/s1 |
| InChIKey | BEKBISBBHFHDFD-PTRXPTGYSA-N |
| XLogP | -1.08 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|