C6H11Cl3O2Si — CID 173094575
chlorosilane;3,3-dichloropropyl prop-2-enoate (PubChem CID 173094575) has the molecular formula C6H11Cl3O2Si and a molecular weight of 249.60 g/mol. Its IUPAC name is chlorosilane;3,3-dichloropropyl prop-2-enoate.
| Compound Name | chlorosilane;3,3-dichloropropyl prop-2-enoate |
|---|---|
| PubChem CID | 173094575 |
| Molecular Formula | C6H11Cl3O2Si |
| Molecular Weight | 249.60 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | chlorosilane;3,3-dichloropropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC(Cl)Cl.[SiH3]Cl |
| InChI | InChI=1S/C6H8Cl2O2.ClH3Si/c1-2-6(9)10-4-3-5(7)8;1-2/h2,5H,1,3-4H2;2H3 |
| InChIKey | YSCNWIOTTHFEBL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.60 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|