C18H22O11Si — CID 141300049
[3-[1,3-di(prop-2-enoyloxy)propoxy-oxosilyl]oxy-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 141300049) has the molecular formula C18H22O11Si and a molecular weight of 442.45 g/mol. Its IUPAC name is [3-[1,3-di(prop-2-enoyloxy)propoxy-oxosilyl]oxy-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [3-[1,3-di(prop-2-enoyloxy)propoxy-oxosilyl]oxy-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 141300049 |
| Molecular Formula | C18H22O11Si |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | [3-[1,3-di(prop-2-enoyloxy)propoxy-oxosilyl]oxy-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(OC(=O)C=C)O[Si](=O)OC(CCOC(=O)C=C)OC(=O)C=C |
| InChI | InChI=1S/C18H22O11Si/c1-5-13(19)24-11-9-17(26-15(21)7-3)28-30(23)29-18(27-16(22)8-4)10-12-25-14(20)6-2/h5-8,17-18H,1-4,9-12H2 |
| InChIKey | JDTTUFGIXWSPSB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|