C12H22O10 — CID 175773611
(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;bis(prop-2-enoic acid) (PubChem CID 175773611) has the molecular formula C12H22O10 and a molecular weight of 326.30 g/mol. Its IUPAC name is (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;bis(prop-2-enoic acid).
| Compound Name | (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;bis(prop-2-enoic acid) |
|---|---|
| PubChem CID | 175773611 |
| Molecular Formula | C12H22O10 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;bis(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H14O6.2C3H4O2/c7-1-3(9)5(11)6(12)4(10)2-8;2*1-2-3(4)5/h3-12H,1-2H2;2*2H,1H2,(H,4,5)/t3-,4+,5-,6-;;/m1../s1 |
| InChIKey | ILSXZVNCQLJUAJ-MGXNYLRYSA-N |
| XLogP | -3.07 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|