C22H34O16 — CID 173101486
(2S,3R)-butane-1,2,3,4-tetrol;hexakis(prop-2-enoic acid) (PubChem CID 173101486) has the molecular formula C22H34O16 and a molecular weight of 554.50 g/mol. Its IUPAC name is (2S,3R)-butane-1,2,3,4-tetrol;hexakis(prop-2-enoic acid).
| Compound Name | (2S,3R)-butane-1,2,3,4-tetrol;hexakis(prop-2-enoic acid) |
|---|---|
| PubChem CID | 173101486 |
| Molecular Formula | C22H34O16 |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | (2S,3R)-butane-1,2,3,4-tetrol;hexakis(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.C=CC(=O)O.OC[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H10O4.6C3H4O2/c5-1-3(7)4(8)2-6;6*1-2-3(4)5/h3-8H,1-2H2;6*2H,1H2,(H,4,5)/t3-,4+;;;;;; |
| InChIKey | GAFQFMYYKKGVRZ-YMSRMQAYSA-N |
| XLogP | -0.77 |
| TPSA | 304.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|