C14H24N2O6 — CID 88530636
N-[2-hydroxy-3-[2-[2-hydroxy-3-(prop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide (PubChem CID 88530636) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is N-[2-hydroxy-3-[2-[2-hydroxy-3-(prop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide.
| Compound Name | N-[2-hydroxy-3-[2-[2-hydroxy-3-(prop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 88530636 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[2-hydroxy-3-[2-[2-hydroxy-3-(prop-2-enoylamino)propoxy]ethoxy]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(O)COCCOCC(O)CNC(=O)C=C |
| InChI | InChI=1S/C14H24N2O6/c1-3-13(19)15-7-11(17)9-21-5-6-22-10-12(18)8-16-14(20)4-2/h3-4,11-12,17-18H,1-2,5-10H2,(H,15,19)(H,16,20) |
| InChIKey | UYQHSDRRUUWHEH-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|