C26H55NO4Si2 — CID 123542524
N-[3-[4-[3-[butyl(dimethyl)silyl]pentan-3-yloxy-dimethylsilyl]-4-methylhexoxy]-2-hydroxypropyl]prop-2-enamide (PubChem CID 123542524) has the molecular formula C26H55NO4Si2 and a molecular weight of 501.90 g/mol. Its IUPAC name is N-[3-[4-[3-[butyl(dimethyl)silyl]pentan-3-yloxy-dimethylsilyl]-4-methylhexoxy]-2-hydroxypropyl]prop-2-enamide.
| Compound Name | N-[3-[4-[3-[butyl(dimethyl)silyl]pentan-3-yloxy-dimethylsilyl]-4-methylhexoxy]-2-hydroxypropyl]prop-2-enamide |
|---|---|
| PubChem CID | 123542524 |
| Molecular Formula | C26H55NO4Si2 |
| Molecular Weight | 501.90 g/mol |
| Exact Mass | 501.37 |
| IUPAC Name | N-[3-[4-[3-[butyl(dimethyl)silyl]pentan-3-yloxy-dimethylsilyl]-4-methylhexoxy]-2-hydroxypropyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(O)COCCCC(C)(CC)[Si](C)(C)OC(CC)(CC)[Si](C)(C)CCCC |
| InChI | InChI=1S/C26H55NO4Si2/c1-11-16-20-32(7,8)26(14-4,15-5)31-33(9,10)25(6,13-3)18-17-19-30-22-23(28)21-27-24(29)12-2/h12,23,28H,2,11,13-22H2,1,3-10H3,(H,27,29) |
| InChIKey | ZOYADUYVZKBXNZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.90 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|