C39H85NO3Si4 — CID 123494258
N,N-bis[4-[2-[butyl(dimethyl)silyl]propan-2-yloxy-dimethylsilyl]-4-methylhexyl]prop-2-enamide (PubChem CID 123494258) has the molecular formula C39H85NO3Si4 and a molecular weight of 728.46 g/mol. Its IUPAC name is N,N-bis[4-[2-[butyl(dimethyl)silyl]propan-2-yloxy-dimethylsilyl]-4-methylhexyl]prop-2-enamide.
| Compound Name | N,N-bis[4-[2-[butyl(dimethyl)silyl]propan-2-yloxy-dimethylsilyl]-4-methylhexyl]prop-2-enamide |
|---|---|
| PubChem CID | 123494258 |
| Molecular Formula | C39H85NO3Si4 |
| Molecular Weight | 728.46 g/mol |
| Exact Mass | 727.56 |
| IUPAC Name | N,N-bis[4-[2-[butyl(dimethyl)silyl]propan-2-yloxy-dimethylsilyl]-4-methylhexyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCCC(C)(CC)[Si](C)(C)OC(C)(C)[Si](C)(C)CCCC)CCCC(C)(CC)[Si](C)(C)OC(C)(C)[Si](C)(C)CCCC |
| InChI | InChI=1S/C39H85NO3Si4/c1-20-25-33-44(12,13)36(6,7)42-46(16,17)38(10,23-4)29-27-31-40(35(41)22-3)32-28-30-39(11,24-5)47(18,19)43-37(8,9)45(14,15)34-26-21-2/h22H,3,20-21,23-34H2,1-2,4-19H3 |
| InChIKey | MNJMAKFWUMWHBZ-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.46 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|