C12H21F2NO — CID 89352114
N-butyl-N-(5,5-difluoropentyl)prop-2-enamide (PubChem CID 89352114) has the molecular formula C12H21F2NO and a molecular weight of 233.30 g/mol. Its IUPAC name is N-butyl-N-(5,5-difluoropentyl)prop-2-enamide.
| Compound Name | N-butyl-N-(5,5-difluoropentyl)prop-2-enamide |
|---|---|
| PubChem CID | 89352114 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-butyl-N-(5,5-difluoropentyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCCC)CCCCC(F)F |
| InChI | InChI=1S/C12H21F2NO/c1-3-5-9-15(12(16)4-2)10-7-6-8-11(13)14/h4,11H,2-3,5-10H2,1H3 |
| InChIKey | AKYAMUSBNKSTMP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|