C13H25NO3 — CID 87130034
N,N-bis(5-hydroxypentyl)prop-2-enamide (PubChem CID 87130034) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N,N-bis(5-hydroxypentyl)prop-2-enamide.
| Compound Name | N,N-bis(5-hydroxypentyl)prop-2-enamide |
|---|---|
| PubChem CID | 87130034 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N,N-bis(5-hydroxypentyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCCCCO)CCCCCO |
| InChI | InChI=1S/C13H25NO3/c1-2-13(17)14(9-5-3-7-11-15)10-6-4-8-12-16/h2,15-16H,1,3-12H2 |
| InChIKey | JGEKFUTUYDOTKN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|