C11H19F2NO — CID 89357676
N-(5,5-difluoropentyl)-N-propylprop-2-enamide (PubChem CID 89357676) has the molecular formula C11H19F2NO and a molecular weight of 219.27 g/mol. Its IUPAC name is N-(5,5-difluoropentyl)-N-propylprop-2-enamide.
| Compound Name | N-(5,5-difluoropentyl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 89357676 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-(5,5-difluoropentyl)-N-propylprop-2-enamide |
| SMILES | C=CC(=O)N(CCC)CCCCC(F)F |
| InChI | InChI=1S/C11H19F2NO/c1-3-8-14(11(15)4-2)9-6-5-7-10(12)13/h4,10H,2-3,5-9H2,1H3 |
| InChIKey | FZZWRONEEWWCMK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|