C13H23NO3 — CID 134486343
2-methylpropyl 3-[prop-2-enoyl(propyl)amino]propanoate (PubChem CID 134486343) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-methylpropyl 3-[prop-2-enoyl(propyl)amino]propanoate.
| Compound Name | 2-methylpropyl 3-[prop-2-enoyl(propyl)amino]propanoate |
|---|---|
| PubChem CID | 134486343 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2-methylpropyl 3-[prop-2-enoyl(propyl)amino]propanoate |
| SMILES | C=CC(=O)N(CCC)CCC(=O)OCC(C)C |
| InChI | InChI=1S/C13H23NO3/c1-5-8-14(12(15)6-2)9-7-13(16)17-10-11(3)4/h6,11H,2,5,7-10H2,1,3-4H3 |
| InChIKey | ALFZTXGUAMUZOH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|