About 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate
2-methylpropyl 6-(dihexylamino)-6-oxohexanoate (PubChem CID 91705306) has the molecular formula C22H43NO3
and a molecular weight of 369.59 g/mol. Its IUPAC name is 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate |
| PubChem CID | 91705306 |
| Molecular Formula | C22H43NO3 |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.32 |
| IUPAC Name | 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate |
| SMILES | CCCCCCN(CCCCCC)C(=O)CCCCC(=O)OCC(C)C |
| InChI | InChI=1S/C22H43NO3/c1-5-7-9-13-17-23(18-14-10-8-6-2)21(24)15-11-12-16-22(25)26-19-20(3)4/h20H,5-19H2,1-4H3 |
| InChIKey | JSTXQIAXXGSPFB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate?
The IUPAC name of 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate (CID 91705306) is 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate.
What is the SMILES notation for 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate?
The canonical SMILES for 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate is CCCCCCN(CCCCCC)C(=O)CCCCC(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate?
The InChIKey is JSTXQIAXXGSPFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H43NO3/c1-5-7-9-13-17-23(18-14-10-8-6-2)21(24)15-11-12-16-22(25)26-19-20(3)4/h20H,5-19H2,1-4H3.
What are the key properties of 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate?
2-methylpropyl 6-(dihexylamino)-6-oxohexanoate has a molecular weight of 369.59 g/mol, XLogP of 5.74, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 6-(dihexylamino)-6-oxohexanoate is sourced from PubChem (CID 91705306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).