C18H34N2O8P2 — CID 134429982
[1-phosphono-7-[prop-2-enoyl-[2-[prop-2-enoyl(propyl)amino]ethyl]amino]heptyl]phosphonic acid (PubChem CID 134429982) has the molecular formula C18H34N2O8P2 and a molecular weight of 468.42 g/mol. Its IUPAC name is [1-phosphono-7-[prop-2-enoyl-[2-[prop-2-enoyl(propyl)amino]ethyl]amino]heptyl]phosphonic acid.
| Compound Name | [1-phosphono-7-[prop-2-enoyl-[2-[prop-2-enoyl(propyl)amino]ethyl]amino]heptyl]phosphonic acid |
|---|---|
| PubChem CID | 134429982 |
| Molecular Formula | C18H34N2O8P2 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [1-phosphono-7-[prop-2-enoyl-[2-[prop-2-enoyl(propyl)amino]ethyl]amino]heptyl]phosphonic acid |
| SMILES | C=CC(=O)N(CCC)CCN(CCCCCCC(P(=O)(O)O)P(=O)(O)O)C(=O)C=C |
| InChI | InChI=1S/C18H34N2O8P2/c1-4-12-19(16(21)5-2)14-15-20(17(22)6-3)13-10-8-7-9-11-18(29(23,24)25)30(26,27)28/h5-6,18H,2-4,7-15H2,1H3,(H2,23,24,25)(H2,26,27,28) |
| InChIKey | WJZLXXSRFHBPPO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|