C15H27N2O6P — CID 23132169
1,3-bis[prop-2-enoyl(propyl)amino]propan-2-yl dihydrogen phosphate (PubChem CID 23132169) has the molecular formula C15H27N2O6P and a molecular weight of 362.36 g/mol. Its IUPAC name is 1,3-bis[prop-2-enoyl(propyl)amino]propan-2-yl dihydrogen phosphate.
| Compound Name | 1,3-bis[prop-2-enoyl(propyl)amino]propan-2-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 23132169 |
| Molecular Formula | C15H27N2O6P |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1,3-bis[prop-2-enoyl(propyl)amino]propan-2-yl dihydrogen phosphate |
| SMILES | C=CC(=O)N(CCC)CC(CN(CCC)C(=O)C=C)OP(=O)(O)O |
| InChI | InChI=1S/C15H27N2O6P/c1-5-9-16(14(18)7-3)11-13(23-24(20,21)22)12-17(10-6-2)15(19)8-4/h7-8,13H,3-6,9-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | HGFPNCCIFWOGHW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|