C9H19NO3 — CID 176950380
N,N-bis(2-hydroxyethyl)prop-2-enamide;ethane (PubChem CID 176950380) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)prop-2-enamide;ethane.
| Compound Name | N,N-bis(2-hydroxyethyl)prop-2-enamide;ethane |
|---|---|
| PubChem CID | 176950380 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)prop-2-enamide;ethane |
| SMILES | C=CC(=O)N(CCO)CCO.CC |
| InChI | InChI=1S/C7H13NO3.C2H6/c1-2-7(11)8(3-5-9)4-6-10;1-2/h2,9-10H,1,3-6H2;1-2H3 |
| InChIKey | MNAOAJVWQPEGLO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|