C17H25NO3 — CID 134446258
N,N-bis[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]prop-2-enamide (PubChem CID 134446258) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is N,N-bis[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]prop-2-enamide.
| Compound Name | N,N-bis[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 134446258 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N,N-bis[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCOC(=C)C(=C)C)CCOC(=C)C(=C)C |
| InChI | InChI=1S/C17H25NO3/c1-8-17(19)18(9-11-20-15(6)13(2)3)10-12-21-16(7)14(4)5/h8H,1-2,4,6-7,9-12H2,3,5H3 |
| InChIKey | LWWIJSGGOGWUKT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|