C10H17NO3 — CID 118885927
N-(2-ethenoxyethoxymethyl)-N-ethylprop-2-enamide (PubChem CID 118885927) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-(2-ethenoxyethoxymethyl)-N-ethylprop-2-enamide.
| Compound Name | N-(2-ethenoxyethoxymethyl)-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 118885927 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | N-(2-ethenoxyethoxymethyl)-N-ethylprop-2-enamide |
| SMILES | C=COCCOCN(CC)C(=O)C=C |
| InChI | InChI=1S/C10H17NO3/c1-4-10(12)11(5-2)9-14-8-7-13-6-3/h4,6H,1,3,5,7-9H2,2H3 |
| InChIKey | ZQRIZVSZAXUNIO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|