C17H29NO6 — CID 58402357
N-[2-hydroxy-3-[4-(2-hydroxy-5-oxohept-6-enoxy)butoxy]propyl]prop-2-enamide (PubChem CID 58402357) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is N-[2-hydroxy-3-[4-(2-hydroxy-5-oxohept-6-enoxy)butoxy]propyl]prop-2-enamide.
| Compound Name | N-[2-hydroxy-3-[4-(2-hydroxy-5-oxohept-6-enoxy)butoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 58402357 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | N-[2-hydroxy-3-[4-(2-hydroxy-5-oxohept-6-enoxy)butoxy]propyl]prop-2-enamide |
| SMILES | C=CC(=O)CCC(O)COCCCCOCC(O)CNC(=O)C=C |
| InChI | InChI=1S/C17H29NO6/c1-3-14(19)7-8-15(20)12-23-9-5-6-10-24-13-16(21)11-18-17(22)4-2/h3-4,15-16,20-21H,1-2,5-13H2,(H,18,22) |
| InChIKey | AJQJQBPQOUDZCR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|