C27H44O6 — CID 139540546
6,13-dihydroxy-10-[(2-hydroxy-5-oxohept-6-enoxy)methyl]-16-methylideneoctadeca-1,17-dien-3-one (PubChem CID 139540546) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is 6,13-dihydroxy-10-[(2-hydroxy-5-oxohept-6-enoxy)methyl]-16-methylideneoctadeca-1,17-dien-3-one.
| Compound Name | 6,13-dihydroxy-10-[(2-hydroxy-5-oxohept-6-enoxy)methyl]-16-methylideneoctadeca-1,17-dien-3-one |
|---|---|
| PubChem CID | 139540546 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | 6,13-dihydroxy-10-[(2-hydroxy-5-oxohept-6-enoxy)methyl]-16-methylideneoctadeca-1,17-dien-3-one |
| SMILES | C=CC(=C)CCC(O)CCC(CCCC(O)CCC(=O)C=C)COCC(O)CCC(=O)C=C |
| InChI | InChI=1S/C27H44O6/c1-5-21(4)11-13-26(31)14-12-22(9-8-10-25(30)17-15-23(28)6-2)19-33-20-27(32)18-16-24(29)7-3/h5-7,22,25-27,30-32H,1-4,8-20H2 |
| InChIKey | SORBVPPGTIUPEA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|