C11H21NO5 — CID 166931985
N-[[(4R)-3-hydroxy-2,4-dimethoxypentoxy]methyl]prop-2-enamide (PubChem CID 166931985) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-[[(4R)-3-hydroxy-2,4-dimethoxypentoxy]methyl]prop-2-enamide.
| Compound Name | N-[[(4R)-3-hydroxy-2,4-dimethoxypentoxy]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166931985 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-[[(4R)-3-hydroxy-2,4-dimethoxypentoxy]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCOCC(OC)C(O)[C@@H](C)OC |
| InChI | InChI=1S/C11H21NO5/c1-5-10(13)12-7-17-6-9(16-4)11(14)8(2)15-3/h5,8-9,11,14H,1,6-7H2,2-4H3,(H,12,13)/t8-,9?,11?/m1/s1 |
| InChIKey | FOLYKGWLSQOQHQ-FKTRJACZSA-N |
| XLogP | -0.33 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|