About N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide
N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide (PubChem CID 174821767) has the molecular formula C13H24N2O4
and a molecular weight of 272.34 g/mol. Its IUPAC name is N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide |
| PubChem CID | 174821767 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NCOCC(C)C.C=CC(=O)NOC |
| InChI | InChI=1S/C9H17NO2.C4H7NO2/c1-7(2)5-12-6-10-9(11)8(3)4;1-3-4(6)5-7-2/h7H,3,5-6H2,1-2,4H3,(H,10,11);3H,1H2,2H3,(H,5,6) |
| InChIKey | QURVUHVVGMDGFI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide?
The IUPAC name of N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide (CID 174821767) is N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide.
What is the SMILES notation for N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide?
The canonical SMILES for N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide is C=C(C)C(=O)NCOCC(C)C.C=CC(=O)NOC.
What is the InChIKey of N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide?
The InChIKey is QURVUHVVGMDGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C4H7NO2/c1-7(2)5-12-6-10-9(11)8(3)4;1-3-4(6)5-7-2/h7H,3,5-6H2,1-2,4H3,(H,10,11);3H,1H2,2H3,(H,5,6).
What are the key properties of N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide?
N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide has a molecular weight of 272.34 g/mol, XLogP of 1.16, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide is sourced from PubChem (CID 174821767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).