C13H24N2O4 — CID 174821767
N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide (PubChem CID 174821767) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide.
| Compound Name | N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide |
|---|---|
| PubChem CID | 174821767 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-methoxyprop-2-enamide;2-methyl-N-(2-methylpropoxymethyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NCOCC(C)C.C=CC(=O)NOC |
| InChI | InChI=1S/C9H17NO2.C4H7NO2/c1-7(2)5-12-6-10-9(11)8(3)4;1-3-4(6)5-7-2/h7H,3,5-6H2,1-2,4H3,(H,10,11);3H,1H2,2H3,(H,5,6) |
| InChIKey | QURVUHVVGMDGFI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|