C10H15NO2 — CID 23525810
N-(2-buta-1,3-dien-2-yloxyethyl)-2-methylprop-2-enamide (PubChem CID 23525810) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-(2-buta-1,3-dien-2-yloxyethyl)-2-methylprop-2-enamide.
| Compound Name | N-(2-buta-1,3-dien-2-yloxyethyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 23525810 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-(2-buta-1,3-dien-2-yloxyethyl)-2-methylprop-2-enamide |
| SMILES | C=CC(=C)OCCNC(=O)C(=C)C |
| InChI | InChI=1S/C10H15NO2/c1-5-9(4)13-7-6-11-10(12)8(2)3/h5H,1-2,4,6-7H2,3H3,(H,11,12) |
| InChIKey | WMHQFNRHXLQEJH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|