C9H15NO4 — CID 87093893
2-(2-methylprop-2-enoylamino)ethyl 2-hydroxypropanoate (PubChem CID 87093893) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoylamino)ethyl 2-hydroxypropanoate.
| Compound Name | 2-(2-methylprop-2-enoylamino)ethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 87093893 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-(2-methylprop-2-enoylamino)ethyl 2-hydroxypropanoate |
| SMILES | C=C(C)C(=O)NCCOC(=O)C(C)O |
| InChI | InChI=1S/C9H15NO4/c1-6(2)8(12)10-4-5-14-9(13)7(3)11/h7,11H,1,4-5H2,2-3H3,(H,10,12) |
| InChIKey | JZVRRJGDFJOIPX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|