About 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate
3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate (PubChem CID 87094013) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate |
| PubChem CID | 87094013 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate |
| SMILES | C=C(C)C(=O)NCCCOC(=O)C(C)O |
| InChI | InChI=1S/C10H17NO4/c1-7(2)9(13)11-5-4-6-15-10(14)8(3)12/h8,12H,1,4-6H2,2-3H3,(H,11,13) |
| InChIKey | OZCZFSSYYFUXCF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate?
The IUPAC name of 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate (CID 87094013) is 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate.
What is the SMILES notation for 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate?
The canonical SMILES for 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate is C=C(C)C(=O)NCCCOC(=O)C(C)O.
What is the InChIKey of 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate?
The InChIKey is OZCZFSSYYFUXCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c1-7(2)9(13)11-5-4-6-15-10(14)8(3)12/h8,12H,1,4-6H2,2-3H3,(H,11,13).
What are the key properties of 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate?
3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate has a molecular weight of 215.25 g/mol, XLogP of -0.01, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylprop-2-enoylamino)propyl 2-hydroxypropanoate is sourced from PubChem (CID 87094013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).