About 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate
3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate (PubChem CID 87558294) has the molecular formula C14H23NO4
and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate.
Molecular Properties
| Compound Name | 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate |
| PubChem CID | 87558294 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate |
| SMILES | C=C(C)C(=O)NCCCOC(=O)CC(=O)CCCC |
| InChI | InChI=1S/C14H23NO4/c1-4-5-7-12(16)10-13(17)19-9-6-8-15-14(18)11(2)3/h2,4-10H2,1,3H3,(H,15,18) |
| InChIKey | FKPWTOYAGJMJMD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate?
The IUPAC name of 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate (CID 87558294) is 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate.
What is the SMILES notation for 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate?
The canonical SMILES for 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate is C=C(C)C(=O)NCCCOC(=O)CC(=O)CCCC.
What is the InChIKey of 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate?
The InChIKey is FKPWTOYAGJMJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO4/c1-4-5-7-12(16)10-13(17)19-9-6-8-15-14(18)11(2)3/h2,4-10H2,1,3H3,(H,15,18).
What are the key properties of 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate?
3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate has a molecular weight of 269.34 g/mol, XLogP of 1.76, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylprop-2-enoylamino)propyl 3-oxoheptanoate is sourced from PubChem (CID 87558294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).