C12H22N2O2 — CID 59773657
2-methyl-N-[3-(2-methylprop-2-enoylamino)propyl]butanamide (PubChem CID 59773657) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-methyl-N-[3-(2-methylprop-2-enoylamino)propyl]butanamide.
| Compound Name | 2-methyl-N-[3-(2-methylprop-2-enoylamino)propyl]butanamide |
|---|---|
| PubChem CID | 59773657 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-methyl-N-[3-(2-methylprop-2-enoylamino)propyl]butanamide |
| SMILES | C=C(C)C(=O)NCCCNC(=O)C(C)CC |
| InChI | InChI=1S/C12H22N2O2/c1-5-10(4)12(16)14-8-6-7-13-11(15)9(2)3/h10H,2,5-8H2,1,3-4H3,(H,13,15)(H,14,16) |
| InChIKey | IZXFVQWVRWWEHO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|