C9H17NO — CID 114618817
2-methyl-N-(2-methylprop-2-enyl)butanamide (PubChem CID 114618817) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 2-methyl-N-(2-methylprop-2-enyl)butanamide.
| Compound Name | 2-methyl-N-(2-methylprop-2-enyl)butanamide |
|---|---|
| PubChem CID | 114618817 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2-methyl-N-(2-methylprop-2-enyl)butanamide |
| SMILES | C=C(C)CNC(=O)C(C)CC |
| InChI | InChI=1S/C9H17NO/c1-5-8(4)9(11)10-6-7(2)3/h8H,2,5-6H2,1,3-4H3,(H,10,11) |
| InChIKey | CWESKXZZPZLNRN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|