C10H17NO4 — CID 59623900
5-(2-methylbutanoylamino)-4-oxopentanoic acid (PubChem CID 59623900) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 5-(2-methylbutanoylamino)-4-oxopentanoic acid.
| Compound Name | 5-(2-methylbutanoylamino)-4-oxopentanoic acid |
|---|---|
| PubChem CID | 59623900 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 5-(2-methylbutanoylamino)-4-oxopentanoic acid |
| SMILES | CCC(C)C(=O)NCC(=O)CCC(=O)O |
| InChI | InChI=1S/C10H17NO4/c1-3-7(2)10(15)11-6-8(12)4-5-9(13)14/h7H,3-6H2,1-2H3,(H,11,15)(H,13,14) |
| InChIKey | OLOMCJIUWJTHPX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |