C9H17N3O2 — CID 87079419
N-but-3-enyl-2-methylprop-2-enamide;urea (PubChem CID 87079419) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-but-3-enyl-2-methylprop-2-enamide;urea.
| Compound Name | N-but-3-enyl-2-methylprop-2-enamide;urea |
|---|---|
| PubChem CID | 87079419 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N-but-3-enyl-2-methylprop-2-enamide;urea |
| SMILES | C=CCCNC(=O)C(=C)C.NC(N)=O |
| InChI | InChI=1S/C8H13NO.CH4N2O/c1-4-5-6-9-8(10)7(2)3;2-1(3)4/h4H,1-2,5-6H2,3H3,(H,9,10);(H4,2,3,4) |
| InChIKey | QSVXXWUAIOHMFG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|