C10H16N2O3 — CID 174484059
2-[2-(2-methylprop-2-enoylamino)ethyl]-3-oxobutanamide (PubChem CID 174484059) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoylamino)ethyl]-3-oxobutanamide.
| Compound Name | 2-[2-(2-methylprop-2-enoylamino)ethyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 174484059 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoylamino)ethyl]-3-oxobutanamide |
| SMILES | C=C(C)C(=O)NCCC(C(C)=O)C(N)=O |
| InChI | InChI=1S/C10H16N2O3/c1-6(2)10(15)12-5-4-8(7(3)13)9(11)14/h8H,1,4-5H2,2-3H3,(H2,11,14)(H,12,15) |
| InChIKey | BWPOEXMANKRANZ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|