C9H17NO4 — CID 87223904
1,1-dimethoxyethane;N-(2-oxoethyl)prop-2-enamide (PubChem CID 87223904) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1,1-dimethoxyethane;N-(2-oxoethyl)prop-2-enamide.
| Compound Name | 1,1-dimethoxyethane;N-(2-oxoethyl)prop-2-enamide |
|---|---|
| PubChem CID | 87223904 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 1,1-dimethoxyethane;N-(2-oxoethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCC=O.COC(C)OC |
| InChI | InChI=1S/C5H7NO2.C4H10O2/c1-2-5(8)6-3-4-7;1-4(5-2)6-3/h2,4H,1,3H2,(H,6,8);4H,1-3H3 |
| InChIKey | FSXJZPRAFWZIIH-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|