C12H18N3O7P — CID 158064105
tris[(prop-2-enoylamino)methyl] phosphate (PubChem CID 158064105) has the molecular formula C12H18N3O7P and a molecular weight of 347.26 g/mol. Its IUPAC name is tris[(prop-2-enoylamino)methyl] phosphate.
| Compound Name | tris[(prop-2-enoylamino)methyl] phosphate |
|---|---|
| PubChem CID | 158064105 |
| Molecular Formula | C12H18N3O7P |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | tris[(prop-2-enoylamino)methyl] phosphate |
| SMILES | C=CC(=O)NCOP(=O)(OCNC(=O)C=C)OCNC(=O)C=C |
| InChI | InChI=1S/C12H18N3O7P/c1-4-10(16)13-7-20-23(19,21-8-14-11(17)5-2)22-9-15-12(18)6-3/h4-6H,1-3,7-9H2,(H,13,16)(H,14,17)(H,15,18) |
| InChIKey | FLAAAHUUJGXBBZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|