C8H12N2O4 — CID 88793107
formic acid;N-[(prop-2-enoylamino)methyl]prop-2-enamide (PubChem CID 88793107) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is formic acid;N-[(prop-2-enoylamino)methyl]prop-2-enamide.
| Compound Name | formic acid;N-[(prop-2-enoylamino)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 88793107 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | formic acid;N-[(prop-2-enoylamino)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCNC(=O)C=C.O=CO |
| InChI | InChI=1S/C7H10N2O2.CH2O2/c1-3-6(10)8-5-9-7(11)4-2;2-1-3/h3-4H,1-2,5H2,(H,8,10)(H,9,11);1H,(H,2,3) |
| InChIKey | RJNOPMJXIBTAQK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|