C8H10O4 — CID 88509439
4,5-dihydroxyocta-1,7-diene-3,6-dione (PubChem CID 88509439) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 4,5-dihydroxyocta-1,7-diene-3,6-dione.
| Compound Name | 4,5-dihydroxyocta-1,7-diene-3,6-dione |
|---|---|
| PubChem CID | 88509439 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 4,5-dihydroxyocta-1,7-diene-3,6-dione |
| SMILES | C=CC(=O)C(O)C(O)C(=O)C=C |
| InChI | InChI=1S/C8H10O4/c1-3-5(9)7(11)8(12)6(10)4-2/h3-4,7-8,11-12H,1-2H2 |
| InChIKey | UKAGYRHMXMLMLB-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|