C22H46O4 — CID 175531574
(2S,3R)-2,4-di(nonoxy)butane-1,3-diol (PubChem CID 175531574) has the molecular formula C22H46O4 and a molecular weight of 374.61 g/mol. Its IUPAC name is (2S,3R)-2,4-di(nonoxy)butane-1,3-diol.
| Compound Name | (2S,3R)-2,4-di(nonoxy)butane-1,3-diol |
|---|---|
| PubChem CID | 175531574 |
| Molecular Formula | C22H46O4 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | (2S,3R)-2,4-di(nonoxy)butane-1,3-diol |
| SMILES | CCCCCCCCCOC[C@@H](O)[C@H](CO)OCCCCCCCCC |
| InChI | InChI=1S/C22H46O4/c1-3-5-7-9-11-13-15-17-25-20-21(24)22(19-23)26-18-16-14-12-10-8-6-4-2/h21-24H,3-20H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | HOYHHWFNFCWZDD-YADHBBJMSA-N |
| XLogP | 5.24 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|