C21H44O6 — CID 88729253
4,5,6-tripentoxyhexane-1,2,3-triol (PubChem CID 88729253) has the molecular formula C21H44O6 and a molecular weight of 392.58 g/mol. Its IUPAC name is 4,5,6-tripentoxyhexane-1,2,3-triol.
| Compound Name | 4,5,6-tripentoxyhexane-1,2,3-triol |
|---|---|
| PubChem CID | 88729253 |
| Molecular Formula | C21H44O6 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | 4,5,6-tripentoxyhexane-1,2,3-triol |
| SMILES | CCCCCOCC(OCCCCC)C(OCCCCC)C(O)C(O)CO |
| InChI | InChI=1S/C21H44O6/c1-4-7-10-13-25-17-19(26-14-11-8-5-2)21(20(24)18(23)16-22)27-15-12-9-6-3/h18-24H,4-17H2,1-3H3 |
| InChIKey | LHQLJGYRMIKFEC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|